C24H32O4S — CID 11101789
(1S,5S,6Z)-9-(benzenesulfonyl)-3,3,7,11,14,14-hexamethyl-2,4-dioxatricyclo[8.3.1.01,5]tetradeca-6,10-diene (PubChem CID 11101789) has the molecular formula C24H32O4S and a molecular weight of 416.58 g/mol. Its IUPAC name is (1S,5S,6Z)-9-(benzenesulfonyl)-3,3,7,11,14,14-hexamethyl-2,4-dioxatricyclo[8.3.1.01,5]tetradeca-6,10-diene.
| Compound Name | (1S,5S,6Z)-9-(benzenesulfonyl)-3,3,7,11,14,14-hexamethyl-2,4-dioxatricyclo[8.3.1.01,5]tetradeca-6,10-diene |
|---|---|
| PubChem CID | 11101789 |
| Molecular Formula | C24H32O4S |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (1S,5S,6Z)-9-(benzenesulfonyl)-3,3,7,11,14,14-hexamethyl-2,4-dioxatricyclo[8.3.1.01,5]tetradeca-6,10-diene |
| SMILES | CC1=C2C(S(=O)(=O)c3ccccc3)C/C(C)=C\[C@@H]3OC(C)(C)O[C@@]3(CC1)C2(C)C |
| InChI | InChI=1S/C24H32O4S/c1-16-14-19(29(25,26)18-10-8-7-9-11-18)21-17(2)12-13-24(22(21,3)4)20(15-16)27-23(5,6)28-24/h7-11,15,19-20H,12-14H2,1-6H3/b16-15-/t19?,20-,24+/m0/s1 |
| InChIKey | BVRZGSCCVCBTAN-QMXDKHTRSA-N |
| XLogP | 5.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|