C25H34O4S — CID 10906135
(4S,5S)-7-(2,3-dihydro-1,4-dioxin-5-yl)-2,2,6,6,8-pentamethyl-4-(2-phenylsulfanylethyl)-1,3-dioxaspiro[4.5]dec-7-ene (PubChem CID 10906135) has the molecular formula C25H34O4S and a molecular weight of 430.61 g/mol. Its IUPAC name is (4S,5S)-7-(2,3-dihydro-1,4-dioxin-5-yl)-2,2,6,6,8-pentamethyl-4-(2-phenylsulfanylethyl)-1,3-dioxaspiro[4.5]dec-7-ene.
| Compound Name | (4S,5S)-7-(2,3-dihydro-1,4-dioxin-5-yl)-2,2,6,6,8-pentamethyl-4-(2-phenylsulfanylethyl)-1,3-dioxaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 10906135 |
| Molecular Formula | C25H34O4S |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (4S,5S)-7-(2,3-dihydro-1,4-dioxin-5-yl)-2,2,6,6,8-pentamethyl-4-(2-phenylsulfanylethyl)-1,3-dioxaspiro[4.5]dec-7-ene |
| SMILES | CC1=C(C2=COCCO2)C(C)(C)[C@]2(CC1)OC(C)(C)O[C@H]2CCSc1ccccc1 |
| InChI | InChI=1S/C25H34O4S/c1-18-11-13-25(23(2,3)22(18)20-17-26-14-15-27-20)21(28-24(4,5)29-25)12-16-30-19-9-7-6-8-10-19/h6-10,17,21H,11-16H2,1-5H3/t21-,25+/m0/s1 |
| InChIKey | MLRWUHYYQAXRHQ-SQJMNOBHSA-N |
| XLogP | 6.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |