C29H42O4S — CID 11102968
(2R,6S)-2-[(4R,5S)-5-[(3,3-dimethyloxiran-2-yl)methyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]-5-methyl-6-[(E)-3-methyl-5-phenylsulfanylpent-3-enyl]-3,6-dihydro-2H-pyran (PubChem CID 11102968) has the molecular formula C29H42O4S and a molecular weight of 486.72 g/mol. Its IUPAC name is (2R,6S)-2-[(4R,5S)-5-[(3,3-dimethyloxiran-2-yl)methyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]-5-methyl-6-[(E)-3-methyl-5-phenylsulfanylpent-3-enyl]-3,6-dihydro-2H-pyran.
| Compound Name | (2R,6S)-2-[(4R,5S)-5-[(3,3-dimethyloxiran-2-yl)methyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]-5-methyl-6-[(E)-3-methyl-5-phenylsulfanylpent-3-enyl]-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 11102968 |
| Molecular Formula | C29H42O4S |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | (2R,6S)-2-[(4R,5S)-5-[(3,3-dimethyloxiran-2-yl)methyl]-2,2,4-trimethyl-1,3-dioxolan-4-yl]-5-methyl-6-[(E)-3-methyl-5-phenylsulfanylpent-3-enyl]-3,6-dihydro-2H-pyran |
| SMILES | CC1=CC[C@H]([C@@]2(C)OC(C)(C)O[C@H]2CC2OC2(C)C)O[C@H]1CC/C(C)=C/CSc1ccccc1 |
| InChI | InChI=1S/C29H42O4S/c1-20(17-18-34-22-11-9-8-10-12-22)13-15-23-21(2)14-16-24(30-23)29(7)26(32-28(5,6)33-29)19-25-27(3,4)31-25/h8-12,14,17,23-26H,13,15-16,18-19H2,1-7H3/b20-17+/t23-,24+,25?,26-,29+/m0/s1 |
| InChIKey | PQAXSDZKLWYBKK-NIORVENWSA-N |
| XLogP | 7.09 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|