C24H30O5S — CID 169192213
(1S,2R,4R,12S)-8-(methoxymethyl)-4-methyl-13-methylidene-7-phenylsulfanylspiro[3,15-dioxatricyclo[10.3.0.02,4]pentadecane-14,2'-oxirane]-9-one (PubChem CID 169192213) has the molecular formula C24H30O5S and a molecular weight of 430.57 g/mol. Its IUPAC name is (1S,2R,4R,12S)-8-(methoxymethyl)-4-methyl-13-methylidene-7-phenylsulfanylspiro[3,15-dioxatricyclo[10.3.0.02,4]pentadecane-14,2'-oxirane]-9-one.
| Compound Name | (1S,2R,4R,12S)-8-(methoxymethyl)-4-methyl-13-methylidene-7-phenylsulfanylspiro[3,15-dioxatricyclo[10.3.0.02,4]pentadecane-14,2'-oxirane]-9-one |
|---|---|
| PubChem CID | 169192213 |
| Molecular Formula | C24H30O5S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (1S,2R,4R,12S)-8-(methoxymethyl)-4-methyl-13-methylidene-7-phenylsulfanylspiro[3,15-dioxatricyclo[10.3.0.02,4]pentadecane-14,2'-oxirane]-9-one |
| SMILES | C=C1[C@@H]2CCC(=O)C(COC)C(Sc3ccccc3)CC[C@@]3(C)O[C@@H]3[C@H]2OC12CO2 |
| InChI | InChI=1S/C24H30O5S/c1-15-17-9-10-19(25)18(13-26-3)20(30-16-7-5-4-6-8-16)11-12-23(2)22(29-23)21(17)28-24(15)14-27-24/h4-8,17-18,20-22H,1,9-14H2,2-3H3/t17-,18?,20?,21-,22+,23+,24?/m0/s1 |
| InChIKey | ZDCAUORVWWCQOK-IHEGUESCSA-N |
| XLogP | 4.01 |
| TPSA | 60.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|