C17H26O6 — CID 25100333
ethyl 3-[(E)-5-ethoxy-5-oxopent-2-enyl]-5-ethyl-2-methoxy-2,3-dihydrofuran-4-carboxylate (PubChem CID 25100333) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is ethyl 3-[(E)-5-ethoxy-5-oxopent-2-enyl]-5-ethyl-2-methoxy-2,3-dihydrofuran-4-carboxylate.
| Compound Name | ethyl 3-[(E)-5-ethoxy-5-oxopent-2-enyl]-5-ethyl-2-methoxy-2,3-dihydrofuran-4-carboxylate |
|---|---|
| PubChem CID | 25100333 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | ethyl 3-[(E)-5-ethoxy-5-oxopent-2-enyl]-5-ethyl-2-methoxy-2,3-dihydrofuran-4-carboxylate |
| SMILES | CCOC(=O)C/C=C/CC1C(C(=O)OCC)=C(CC)OC1OC |
| InChI | InChI=1S/C17H26O6/c1-5-13-15(16(19)22-7-3)12(17(20-4)23-13)10-8-9-11-14(18)21-6-2/h8-9,12,17H,5-7,10-11H2,1-4H3/b9-8+ |
| InChIKey | CFXWGINIGYBLSC-CMDGGOBGSA-N |
| XLogP | 2.73 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|