C22H14ClF2N3 — CID 25100744
3-(4-chlorophenyl)-1-(1,1-difluorobuta-1,3-dien-2-yl)-2-pyridin-4-ylpyrrolo[3,2-b]pyridine (PubChem CID 25100744) has the molecular formula C22H14ClF2N3 and a molecular weight of 393.82 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(1,1-difluorobuta-1,3-dien-2-yl)-2-pyridin-4-ylpyrrolo[3,2-b]pyridine.
| Compound Name | 3-(4-chlorophenyl)-1-(1,1-difluorobuta-1,3-dien-2-yl)-2-pyridin-4-ylpyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 25100744 |
| Molecular Formula | C22H14ClF2N3 |
| Molecular Weight | 393.82 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(1,1-difluorobuta-1,3-dien-2-yl)-2-pyridin-4-ylpyrrolo[3,2-b]pyridine |
| SMILES | C=CC(=C(F)F)n1c(-c2ccncc2)c(-c2ccc(Cl)cc2)c2ncccc21 |
| InChI | InChI=1S/C22H14ClF2N3/c1-2-17(22(24)25)28-18-4-3-11-27-20(18)19(14-5-7-16(23)8-6-14)21(28)15-9-12-26-13-10-15/h2-13H,1H2 |
| InChIKey | FTBLNSGBBKMFFQ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.82 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|