C31H31N3O7S — CID 25101905
benzyl N-[(3R)-4-(hydroxyamino)-4-oxo-3-[phenylmethoxy-(4-phenylphenyl)sulfonylamino]butyl]carbamate (PubChem CID 25101905) has the molecular formula C31H31N3O7S and a molecular weight of 589.67 g/mol. Its IUPAC name is benzyl N-[(3R)-4-(hydroxyamino)-4-oxo-3-[phenylmethoxy-(4-phenylphenyl)sulfonylamino]butyl]carbamate.
| Compound Name | benzyl N-[(3R)-4-(hydroxyamino)-4-oxo-3-[phenylmethoxy-(4-phenylphenyl)sulfonylamino]butyl]carbamate |
|---|---|
| PubChem CID | 25101905 |
| Molecular Formula | C31H31N3O7S |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | benzyl N-[(3R)-4-(hydroxyamino)-4-oxo-3-[phenylmethoxy-(4-phenylphenyl)sulfonylamino]butyl]carbamate |
| SMILES | O=C(NCC[C@H](C(=O)NO)N(OCc1ccccc1)S(=O)(=O)c1ccc(-c2ccccc2)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C31H31N3O7S/c35-30(33-37)29(20-21-32-31(36)40-22-24-10-4-1-5-11-24)34(41-23-25-12-6-2-7-13-25)42(38,39)28-18-16-27(17-19-28)26-14-8-3-9-15-26/h1-19,29,37H,20-23H2,(H,32,36)(H,33,35)/t29-/m1/s1 |
| InChIKey | IUJCMFMBFHKIGT-GDLZYMKVSA-N |
| XLogP | 4.67 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|