C14H14N2O7 — CID 25104066
(2S,4aR,7aS)-2-methoxy-4-(2-nitrobenzoyl)-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazin-5-one (PubChem CID 25104066) has the molecular formula C14H14N2O7 and a molecular weight of 322.27 g/mol. Its IUPAC name is (2S,4aR,7aS)-2-methoxy-4-(2-nitrobenzoyl)-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazin-5-one.
| Compound Name | (2S,4aR,7aS)-2-methoxy-4-(2-nitrobenzoyl)-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazin-5-one |
|---|---|
| PubChem CID | 25104066 |
| Molecular Formula | C14H14N2O7 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | (2S,4aR,7aS)-2-methoxy-4-(2-nitrobenzoyl)-3,4a,7,7a-tetrahydro-2H-furo[3,4-b][1,4]oxazin-5-one |
| SMILES | CO[C@@H]1CN(C(=O)c2ccccc2[N+](=O)[O-])[C@H]2C(=O)OC[C@H]2O1 |
| InChI | InChI=1S/C14H14N2O7/c1-21-11-6-15(12-10(23-11)7-22-14(12)18)13(17)8-4-2-3-5-9(8)16(19)20/h2-5,10-12H,6-7H2,1H3/t10-,11+,12-/m1/s1 |
| InChIKey | GXXFQTYFHYTEDS-GRYCIOLGSA-N |
| XLogP | 0.33 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|