C16H16N2O — CID 25108275
10,10-dimethyl-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene (PubChem CID 25108275) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 10,10-dimethyl-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene.
| Compound Name | 10,10-dimethyl-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene |
|---|---|
| PubChem CID | 25108275 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 10,10-dimethyl-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene |
| SMILES | CC1(C)CCc2c(c3ccccc3c3[nH]cnc23)O1 |
| InChI | InChI=1S/C16H16N2O/c1-16(2)8-7-12-14-13(17-9-18-14)10-5-3-4-6-11(10)15(12)19-16/h3-6,9H,7-8H2,1-2H3,(H,17,18) |
| InChIKey | VBZMEHNTFOKKEO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |