C42H50O15 — CID 25108374
[6-[(2S,3R,4R,5S,6S)-3,4-diacetyloxy-6-methyl-5-(4-oxopentanoyloxy)oxan-2-yl]oxy-8-hexanoyloxy-3-methyl-9,10-dioxoanthracen-1-yl] hexanoate (PubChem CID 25108374) has the molecular formula C42H50O15 and a molecular weight of 794.85 g/mol. Its IUPAC name is [6-[(2S,3R,4R,5S,6S)-3,4-diacetyloxy-6-methyl-5-(4-oxopentanoyloxy)oxan-2-yl]oxy-8-hexanoyloxy-3-methyl-9,10-dioxoanthracen-1-yl] hexanoate.
| Compound Name | [6-[(2S,3R,4R,5S,6S)-3,4-diacetyloxy-6-methyl-5-(4-oxopentanoyloxy)oxan-2-yl]oxy-8-hexanoyloxy-3-methyl-9,10-dioxoanthracen-1-yl] hexanoate |
|---|---|
| PubChem CID | 25108374 |
| Molecular Formula | C42H50O15 |
| Molecular Weight | 794.85 g/mol |
| Exact Mass | 794.31 |
| IUPAC Name | [6-[(2S,3R,4R,5S,6S)-3,4-diacetyloxy-6-methyl-5-(4-oxopentanoyloxy)oxan-2-yl]oxy-8-hexanoyloxy-3-methyl-9,10-dioxoanthracen-1-yl] hexanoate |
| SMILES | CCCCCC(=O)Oc1cc(C)cc2c1C(=O)c1c(OC(=O)CCCCC)cc(O[C@@H]3O[C@@H](C)[C@H](OC(=O)CCC(C)=O)[C@@H](OC(C)=O)[C@H]3OC(C)=O)cc1C2=O |
| InChI | InChI=1S/C42H50O15/c1-8-10-12-14-32(46)55-30-19-22(3)18-28-35(30)38(50)36-29(37(28)49)20-27(21-31(36)56-33(47)15-13-11-9-2)54-42-41(53-26(7)45)40(52-25(6)44)39(24(5)51-42)57-34(48)17-16-23(4)43/h18-21,24,39-42H,8-17H2,1-7H3/t24-,39-,40+,41+,42-/m0/s1 |
| InChIKey | UPFBHLTUZSGUBM-NYFRNKHSSA-N |
| XLogP | 6.01 |
| TPSA | 201.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.85 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|