C18H20F2N2O2S — CID 25109441
3-[6-fluoro-1-(2-fluorophenyl)-2,2-dioxo-3,4-dihydro-2λ6,1-benzothiazin-3-yl]-N-methylpropan-1-amine (PubChem CID 25109441) has the molecular formula C18H20F2N2O2S and a molecular weight of 366.43 g/mol. Its IUPAC name is 3-[6-fluoro-1-(2-fluorophenyl)-2,2-dioxo-3,4-dihydro-2λ6,1-benzothiazin-3-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[6-fluoro-1-(2-fluorophenyl)-2,2-dioxo-3,4-dihydro-2λ6,1-benzothiazin-3-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 25109441 |
| Molecular Formula | C18H20F2N2O2S |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-[6-fluoro-1-(2-fluorophenyl)-2,2-dioxo-3,4-dihydro-2λ6,1-benzothiazin-3-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCC1Cc2cc(F)ccc2N(c2ccccc2F)S1(=O)=O |
| InChI | InChI=1S/C18H20F2N2O2S/c1-21-10-4-5-15-12-13-11-14(19)8-9-17(13)22(25(15,23)24)18-7-3-2-6-16(18)20/h2-3,6-9,11,15,21H,4-5,10,12H2,1H3 |
| InChIKey | CLLQMGVKRYVVFS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|