C20H9N5O3S — CID 25112791
14-(1,3-benzodioxol-5-yl)-12-oxo-17-thia-2,9,11,15-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,13,15-heptaene-13-carbonitrile (PubChem CID 25112791) has the molecular formula C20H9N5O3S and a molecular weight of 399.39 g/mol. Its IUPAC name is 14-(1,3-benzodioxol-5-yl)-12-oxo-17-thia-2,9,11,15-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,13,15-heptaene-13-carbonitrile.
| Compound Name | 14-(1,3-benzodioxol-5-yl)-12-oxo-17-thia-2,9,11,15-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,13,15-heptaene-13-carbonitrile |
|---|---|
| PubChem CID | 25112791 |
| Molecular Formula | C20H9N5O3S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 14-(1,3-benzodioxol-5-yl)-12-oxo-17-thia-2,9,11,15-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,13,15-heptaene-13-carbonitrile |
| SMILES | N#Cc1c(-c2ccc3c(c2)OCO3)nc2sc3nc4ccccc4nc3n2c1=O |
| InChI | InChI=1S/C20H9N5O3S/c21-8-11-16(10-5-6-14-15(7-10)28-9-27-14)24-20-25(19(11)26)17-18(29-20)23-13-4-2-1-3-12(13)22-17/h1-7H,9H2 |
| InChIKey | FXMZSBVZCXZDOE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 102.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|