C15H13N5O4 — CID 13381290
N'-[4-(1,3-benzodioxol-5-yl)-5-cyano-1-methyl-6-oxopyrimidin-2-yl]acetohydrazide (PubChem CID 13381290) has the molecular formula C15H13N5O4 and a molecular weight of 327.30 g/mol. Its IUPAC name is N'-[4-(1,3-benzodioxol-5-yl)-5-cyano-1-methyl-6-oxopyrimidin-2-yl]acetohydrazide.
| Compound Name | N'-[4-(1,3-benzodioxol-5-yl)-5-cyano-1-methyl-6-oxopyrimidin-2-yl]acetohydrazide |
|---|---|
| PubChem CID | 13381290 |
| Molecular Formula | C15H13N5O4 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N'-[4-(1,3-benzodioxol-5-yl)-5-cyano-1-methyl-6-oxopyrimidin-2-yl]acetohydrazide |
| SMILES | CC(=O)NNc1nc(-c2ccc3c(c2)OCO3)c(C#N)c(=O)n1C |
| InChI | InChI=1S/C15H13N5O4/c1-8(21)18-19-15-17-13(10(6-16)14(22)20(15)2)9-3-4-11-12(5-9)24-7-23-11/h3-5H,7H2,1-2H3,(H,17,19)(H,18,21) |
| InChIKey | IDYADWSYSKAPJS-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 118.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|