C21H15Cl2N5O3 — CID 10874142
2-[[3-chloro-2-(4-hydroxyphenyl)-4-oxoazetidin-1-yl]amino]-4-(4-chlorophenyl)-1-methyl-6-oxopyrimidine-5-carbonitrile (PubChem CID 10874142) has the molecular formula C21H15Cl2N5O3 and a molecular weight of 456.29 g/mol. Its IUPAC name is 2-[[3-chloro-2-(4-hydroxyphenyl)-4-oxoazetidin-1-yl]amino]-4-(4-chlorophenyl)-1-methyl-6-oxopyrimidine-5-carbonitrile.
| Compound Name | 2-[[3-chloro-2-(4-hydroxyphenyl)-4-oxoazetidin-1-yl]amino]-4-(4-chlorophenyl)-1-methyl-6-oxopyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 10874142 |
| Molecular Formula | C21H15Cl2N5O3 |
| Molecular Weight | 456.29 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | 2-[[3-chloro-2-(4-hydroxyphenyl)-4-oxoazetidin-1-yl]amino]-4-(4-chlorophenyl)-1-methyl-6-oxopyrimidine-5-carbonitrile |
| SMILES | Cn1c(NN2C(=O)C(Cl)C2c2ccc(O)cc2)nc(-c2ccc(Cl)cc2)c(C#N)c1=O |
| InChI | InChI=1S/C21H15Cl2N5O3/c1-27-19(30)15(10-24)17(11-2-6-13(22)7-3-11)25-21(27)26-28-18(16(23)20(28)31)12-4-8-14(29)9-5-12/h2-9,16,18,29H,1H3,(H,25,26) |
| InChIKey | MAFVZKJRRNULTK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|