C19H12BrClN4OS — CID 50900017
3-(4-bromophenyl)-8-(4-chlorophenyl)-6-oxo-2,4-dihydropyrimido[2,1-b][1,3,5]thiadiazine-7-carbonitrile (PubChem CID 50900017) has the molecular formula C19H12BrClN4OS and a molecular weight of 459.76 g/mol. Its IUPAC name is 3-(4-bromophenyl)-8-(4-chlorophenyl)-6-oxo-2,4-dihydropyrimido[2,1-b][1,3,5]thiadiazine-7-carbonitrile.
| Compound Name | 3-(4-bromophenyl)-8-(4-chlorophenyl)-6-oxo-2,4-dihydropyrimido[2,1-b][1,3,5]thiadiazine-7-carbonitrile |
|---|---|
| PubChem CID | 50900017 |
| Molecular Formula | C19H12BrClN4OS |
| Molecular Weight | 459.76 g/mol |
| Exact Mass | 457.96 |
| IUPAC Name | 3-(4-bromophenyl)-8-(4-chlorophenyl)-6-oxo-2,4-dihydropyrimido[2,1-b][1,3,5]thiadiazine-7-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2)nc2n(c1=O)CN(c1ccc(Br)cc1)CS2 |
| InChI | InChI=1S/C19H12BrClN4OS/c20-13-3-7-15(8-4-13)24-10-25-18(26)16(9-22)17(23-19(25)27-11-24)12-1-5-14(21)6-2-12/h1-8H,10-11H2 |
| InChIKey | GKVDOOZXSALZEG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.76 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|