C13H6BrN3O2S — CID 21232254
7-(4-bromophenyl)-3,5-dioxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile (PubChem CID 21232254) has the molecular formula C13H6BrN3O2S and a molecular weight of 348.18 g/mol. Its IUPAC name is 7-(4-bromophenyl)-3,5-dioxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile.
| Compound Name | 7-(4-bromophenyl)-3,5-dioxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 21232254 |
| Molecular Formula | C13H6BrN3O2S |
| Molecular Weight | 348.18 g/mol |
| Exact Mass | 346.94 |
| IUPAC Name | 7-(4-bromophenyl)-3,5-dioxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Br)cc2)nc2n(c1=O)C(=O)CS2 |
| InChI | InChI=1S/C13H6BrN3O2S/c14-8-3-1-7(2-4-8)11-9(5-15)12(19)17-10(18)6-20-13(17)16-11/h1-4H,6H2 |
| InChIKey | OKEHKSAYFVCEPB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|