C24H13N5O3S — CID 53474467
7-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-3,5-dioxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile (PubChem CID 53474467) has the molecular formula C24H13N5O3S and a molecular weight of 451.47 g/mol. Its IUPAC name is 7-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-3,5-dioxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile.
| Compound Name | 7-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-3,5-dioxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 53474467 |
| Molecular Formula | C24H13N5O3S |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | 7-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-3,5-dioxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile |
| SMILES | N#Cc1c(-c2cn(-c3ccccc3)nc2-c2cc3ccccc3o2)nc2n(c1=O)C(=O)CS2 |
| InChI | InChI=1S/C24H13N5O3S/c25-11-16-21(26-24-29(23(16)31)20(30)13-33-24)17-12-28(15-7-2-1-3-8-15)27-22(17)19-10-14-6-4-5-9-18(14)32-19/h1-10,12H,13H2 |
| InChIKey | UXADUXIBTYGVQY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 106.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|