C14H12N4OS — CID 163699581
8-(6-methyl-3-pyridinyl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile (PubChem CID 163699581) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is 8-(6-methyl-3-pyridinyl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile.
| Compound Name | 8-(6-methyl-3-pyridinyl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile |
|---|---|
| PubChem CID | 163699581 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 8-(6-methyl-3-pyridinyl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile |
| SMILES | Cc1ccc(-c2nc3n(c(=O)c2C#N)CCCS3)cn1 |
| InChI | InChI=1S/C14H12N4OS/c1-9-3-4-10(8-16-9)12-11(7-15)13(19)18-5-2-6-20-14(18)17-12/h3-4,8H,2,5-6H2,1H3 |
| InChIKey | DSVNULHUPXXDKF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|