C12H9N5OS — CID 166990364
6-oxo-8-pyridin-3-yl-3,4-dihydro-2H-pyrimido[2,1-b][1,3,5]thiadiazine-7-carbonitrile (PubChem CID 166990364) has the molecular formula C12H9N5OS and a molecular weight of 271.30 g/mol. Its IUPAC name is 6-oxo-8-pyridin-3-yl-3,4-dihydro-2H-pyrimido[2,1-b][1,3,5]thiadiazine-7-carbonitrile.
| Compound Name | 6-oxo-8-pyridin-3-yl-3,4-dihydro-2H-pyrimido[2,1-b][1,3,5]thiadiazine-7-carbonitrile |
|---|---|
| PubChem CID | 166990364 |
| Molecular Formula | C12H9N5OS |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 6-oxo-8-pyridin-3-yl-3,4-dihydro-2H-pyrimido[2,1-b][1,3,5]thiadiazine-7-carbonitrile |
| SMILES | N#Cc1c(-c2cccnc2)nc2n(c1=O)CNCS2 |
| InChI | InChI=1S/C12H9N5OS/c13-4-9-10(8-2-1-3-14-5-8)16-12-17(11(9)18)6-15-7-19-12/h1-3,5,15H,6-7H2 |
| InChIKey | GWIPONCVSQRJHO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|