C22H20N4O8S — CID 102295818
[(2R,4R,5R,6S,7S)-5,6-diacetyloxy-12-cyano-13-oxo-11-pyridin-3-yl-3-oxa-8-thia-1,10-diazatricyclo[7.4.0.02,7]trideca-9,11-dien-4-yl]methyl acetate (PubChem CID 102295818) has the molecular formula C22H20N4O8S and a molecular weight of 500.49 g/mol. Its IUPAC name is [(2R,4R,5R,6S,7S)-5,6-diacetyloxy-12-cyano-13-oxo-11-pyridin-3-yl-3-oxa-8-thia-1,10-diazatricyclo[7.4.0.02,7]trideca-9,11-dien-4-yl]methyl acetate.
| Compound Name | [(2R,4R,5R,6S,7S)-5,6-diacetyloxy-12-cyano-13-oxo-11-pyridin-3-yl-3-oxa-8-thia-1,10-diazatricyclo[7.4.0.02,7]trideca-9,11-dien-4-yl]methyl acetate |
|---|---|
| PubChem CID | 102295818 |
| Molecular Formula | C22H20N4O8S |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | [(2R,4R,5R,6S,7S)-5,6-diacetyloxy-12-cyano-13-oxo-11-pyridin-3-yl-3-oxa-8-thia-1,10-diazatricyclo[7.4.0.02,7]trideca-9,11-dien-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]2[C@@H](Sc3nc(-c4cccnc4)c(C#N)c(=O)n32)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H20N4O8S/c1-10(27)31-9-15-17(32-11(2)28)18(33-12(3)29)19-21(34-15)26-20(30)14(7-23)16(25-22(26)35-19)13-5-4-6-24-8-13/h4-6,8,15,17-19,21H,9H2,1-3H3/t15-,17-,18+,19+,21-/m1/s1 |
| InChIKey | WYXVNSSBEQCBBJ-VEYVCITQSA-N |
| XLogP | 0.98 |
| TPSA | 159.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|