C30H33N3O9S — CID 11181034
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3-cyano-4-pyridin-3-yl-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl)sulfanyl]oxan-2-yl]methyl acetate (PubChem CID 11181034) has the molecular formula C30H33N3O9S and a molecular weight of 611.67 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3-cyano-4-pyridin-3-yl-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl)sulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3-cyano-4-pyridin-3-yl-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl)sulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11181034 |
| Molecular Formula | C30H33N3O9S |
| Molecular Weight | 611.67 g/mol |
| Exact Mass | 611.19 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3-cyano-4-pyridin-3-yl-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-2-yl)sulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Sc2nc3c(c(-c4cccnc4)c2C#N)CCCCC3)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H33N3O9S/c1-16(34)38-15-24-26(39-17(2)35)27(40-18(3)36)28(41-19(4)37)30(42-24)43-29-22(13-31)25(20-9-8-12-32-14-20)21-10-6-5-7-11-23(21)33-29/h8-9,12,14,24,26-28,30H,5-7,10-11,15H2,1-4H3/t24-,26+,27+,28-,30+/m1/s1 |
| InChIKey | NOMRWLAPRLOSKT-WRHGPDBOSA-N |
| XLogP | 3.46 |
| TPSA | 164.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.67 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|