C28H29N3O9S — CID 11296202
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3-cyano-4-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)sulfanyl]oxan-2-yl]methyl acetate (PubChem CID 11296202) has the molecular formula C28H29N3O9S and a molecular weight of 583.62 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3-cyano-4-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)sulfanyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3-cyano-4-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)sulfanyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11296202 |
| Molecular Formula | C28H29N3O9S |
| Molecular Weight | 583.62 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[(3-cyano-4-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[b]pyridin-2-yl)sulfanyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Sc2nc3c(c(-c4ccncc4)c2C#N)CCC3)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C28H29N3O9S/c1-14(32)36-13-22-24(37-15(2)33)25(38-16(3)34)26(39-17(4)35)28(40-22)41-27-20(12-29)23(18-8-10-30-11-9-18)19-6-5-7-21(19)31-27/h8-11,22,24-26,28H,5-7,13H2,1-4H3/t22-,24+,25+,26-,28+/m1/s1 |
| InChIKey | XABXRGBWBKASEA-OPAVMKTMSA-N |
| XLogP | 2.68 |
| TPSA | 164.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.62 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|