C14H10BrN3OS — CID 17383271
8-(3-bromophenyl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile (PubChem CID 17383271) has the molecular formula C14H10BrN3OS and a molecular weight of 348.23 g/mol. Its IUPAC name is 8-(3-bromophenyl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile.
| Compound Name | 8-(3-bromophenyl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile |
|---|---|
| PubChem CID | 17383271 |
| Molecular Formula | C14H10BrN3OS |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | 8-(3-bromophenyl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-7-carbonitrile |
| SMILES | N#Cc1c(-c2cccc(Br)c2)nc2n(c1=O)CCCS2 |
| InChI | InChI=1S/C14H10BrN3OS/c15-10-4-1-3-9(7-10)12-11(8-16)13(19)18-5-2-6-20-14(18)17-12/h1,3-4,7H,2,5-6H2 |
| InChIKey | LOFXAKVCGLYZFI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|