C17H17N5O3S — CID 50900116
3-(2-methylpropyl)-8-(4-nitrophenyl)-6-oxo-2,4-dihydropyrimido[2,1-b][1,3,5]thiadiazine-7-carbonitrile (PubChem CID 50900116) has the molecular formula C17H17N5O3S and a molecular weight of 371.42 g/mol. Its IUPAC name is 3-(2-methylpropyl)-8-(4-nitrophenyl)-6-oxo-2,4-dihydropyrimido[2,1-b][1,3,5]thiadiazine-7-carbonitrile.
| Compound Name | 3-(2-methylpropyl)-8-(4-nitrophenyl)-6-oxo-2,4-dihydropyrimido[2,1-b][1,3,5]thiadiazine-7-carbonitrile |
|---|---|
| PubChem CID | 50900116 |
| Molecular Formula | C17H17N5O3S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 3-(2-methylpropyl)-8-(4-nitrophenyl)-6-oxo-2,4-dihydropyrimido[2,1-b][1,3,5]thiadiazine-7-carbonitrile |
| SMILES | CC(C)CN1CSc2nc(-c3ccc([N+](=O)[O-])cc3)c(C#N)c(=O)n2C1 |
| InChI | InChI=1S/C17H17N5O3S/c1-11(2)8-20-9-21-16(23)14(7-18)15(19-17(21)26-10-20)12-3-5-13(6-4-12)22(24)25/h3-6,11H,8-10H2,1-2H3 |
| InChIKey | FHGQBCSAMCMDIA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 105.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|