C30H30N4O6 — CID 25115444
trans-(1R,2S)-2-ethenyl-1-[[(2S,4R)-4-(fluoren-9-ylideneamino)oxy-1-[(2S)-6-oxopiperidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylic acid (PubChem CID 25115444) has the molecular formula C30H30N4O6 and a molecular weight of 542.59 g/mol. Its IUPAC name is trans-(1R,2S)-2-ethenyl-1-[[(2S,4R)-4-(fluoren-9-ylideneamino)oxy-1-[(2S)-6-oxopiperidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylic acid.
| Compound Name | trans-(1R,2S)-2-ethenyl-1-[[(2S,4R)-4-(fluoren-9-ylideneamino)oxy-1-[(2S)-6-oxopiperidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 25115444 |
| Molecular Formula | C30H30N4O6 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | trans-(1R,2S)-2-ethenyl-1-[[(2S,4R)-4-(fluoren-9-ylideneamino)oxy-1-[(2S)-6-oxopiperidine-2-carbonyl]pyrrolidine-2-carbonyl]amino]cyclopropane-1-carboxylic acid |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@H](ON=C2c3ccccc3-c3ccccc32)CN1C(=O)[C@@H]1CCCC(=O)N1)C(=O)O |
| InChI | InChI=1S/C30H30N4O6/c1-2-17-15-30(17,29(38)39)32-27(36)24-14-18(16-34(24)28(37)23-12-7-13-25(35)31-23)40-33-26-21-10-5-3-8-19(21)20-9-4-6-11-22(20)26/h2-6,8-11,17-18,23-24H,1,7,12-16H2,(H,31,35)(H,32,36)(H,38,39)/t17-,18-,23+,24+,30-/m1/s1 |
| InChIKey | WFIDFGHELPNVPD-JHEVTHRJSA-N |
| XLogP | 2.22 |
| TPSA | 137.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|