C34H38N4O6S — CID 25141983
1-(2-cyclopentylacetyl)-N-[(1S,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-(fluoren-9-ylideneamino)oxypyrrolidine-2-carboxamide (PubChem CID 25141983) has the molecular formula C34H38N4O6S and a molecular weight of 630.77 g/mol. Its IUPAC name is 1-(2-cyclopentylacetyl)-N-[(1S,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-(fluoren-9-ylideneamino)oxypyrrolidine-2-carboxamide.
| Compound Name | 1-(2-cyclopentylacetyl)-N-[(1S,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-(fluoren-9-ylideneamino)oxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 25141983 |
| Molecular Formula | C34H38N4O6S |
| Molecular Weight | 630.77 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | 1-(2-cyclopentylacetyl)-N-[(1S,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-(fluoren-9-ylideneamino)oxypyrrolidine-2-carboxamide |
| SMILES | C=C[C@@H]1C[C@@]1(NC(=O)C1CC(ON=C2c3ccccc3-c3ccccc32)CN1C(=O)CC1CCCC1)C(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C34H38N4O6S/c1-2-22-19-34(22,33(41)37-45(42,43)24-15-16-24)35-32(40)29-18-23(20-38(29)30(39)17-21-9-3-4-10-21)44-36-31-27-13-7-5-11-25(27)26-12-6-8-14-28(26)31/h2,5-8,11-14,21-24,29H,1,3-4,9-10,15-20H2,(H,35,40)(H,37,41)/t22-,23?,29?,34+/m1/s1 |
| InChIKey | JDSHLYZPVDSHTP-FQWLQDKQSA-N |
| XLogP | 3.66 |
| TPSA | 134.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.77 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|