C32H37N5O6S — CID 25142386
1-N-tert-butyl-2-N-[(1S,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-(fluoren-9-ylideneamino)oxypyrrolidine-1,2-dicarboxamide (PubChem CID 25142386) has the molecular formula C32H37N5O6S and a molecular weight of 619.74 g/mol. Its IUPAC name is 1-N-tert-butyl-2-N-[(1S,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-(fluoren-9-ylideneamino)oxypyrrolidine-1,2-dicarboxamide.
| Compound Name | 1-N-tert-butyl-2-N-[(1S,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-(fluoren-9-ylideneamino)oxypyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 25142386 |
| Molecular Formula | C32H37N5O6S |
| Molecular Weight | 619.74 g/mol |
| Exact Mass | 619.25 |
| IUPAC Name | 1-N-tert-butyl-2-N-[(1S,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]-4-(fluoren-9-ylideneamino)oxypyrrolidine-1,2-dicarboxamide |
| SMILES | C=C[C@@H]1C[C@@]1(NC(=O)C1CC(ON=C2c3ccccc3-c3ccccc32)CN1C(=O)NC(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C32H37N5O6S/c1-5-19-17-32(19,29(39)36-44(41,42)21-14-15-21)33-28(38)26-16-20(18-37(26)30(40)34-31(2,3)4)43-35-27-24-12-8-6-10-22(24)23-11-7-9-13-25(23)27/h5-13,19-21,26H,1,14-18H2,2-4H3,(H,33,38)(H,34,40)(H,36,39)/t19-,20?,26?,32+/m1/s1 |
| InChIKey | RDPLXOVDVFXHOC-QNFLYFKYSA-N |
| XLogP | 3.06 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.74 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|