C33H38N6O8S — CID 25134902
tert-butyl N-[[(2S)-2-[[(2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-4-(fluoren-9-ylideneamino)oxypyrrolidine-1-carbonyl]amino]carbamate (PubChem CID 25134902) has the molecular formula C33H38N6O8S and a molecular weight of 678.77 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-2-[[(2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-4-(fluoren-9-ylideneamino)oxypyrrolidine-1-carbonyl]amino]carbamate.
| Compound Name | tert-butyl N-[[(2S)-2-[[(2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-4-(fluoren-9-ylideneamino)oxypyrrolidine-1-carbonyl]amino]carbamate |
|---|---|
| PubChem CID | 25134902 |
| Molecular Formula | C33H38N6O8S |
| Molecular Weight | 678.77 g/mol |
| Exact Mass | 678.25 |
| IUPAC Name | tert-butyl N-[[(2S)-2-[[(2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]-4-(fluoren-9-ylideneamino)oxypyrrolidine-1-carbonyl]amino]carbamate |
| SMILES | C=C[C@@H]1CC1(NC(=O)[C@@H]1CC(ON=C2c3ccccc3-c3ccccc32)CN1C(=O)NNC(=O)OC(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
| InChI | InChI=1S/C33H38N6O8S/c1-5-19-17-33(19,29(41)38-48(44,45)21-14-15-21)34-28(40)26-16-20(18-39(26)30(42)35-36-31(43)46-32(2,3)4)47-37-27-24-12-8-6-10-22(24)23-11-7-9-13-25(23)27/h5-13,19-21,26H,1,14-18H2,2-4H3,(H,34,40)(H,35,42)(H,36,43)(H,38,41)/t19-,20?,26+,33?/m1/s1 |
| InChIKey | PHLWEBSVESZBAF-KIOULLPQSA-N |
| XLogP | 2.70 |
| TPSA | 184.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.77 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|