C20H20FN3O5S — CID 25118182
methyl N-[4-[[2-(4-fluoroindol-1-yl)-2-methylpropanoyl]amino]phenyl]sulfonylcarbamate (PubChem CID 25118182) has the molecular formula C20H20FN3O5S and a molecular weight of 433.46 g/mol. Its IUPAC name is methyl N-[4-[[2-(4-fluoroindol-1-yl)-2-methylpropanoyl]amino]phenyl]sulfonylcarbamate.
| Compound Name | methyl N-[4-[[2-(4-fluoroindol-1-yl)-2-methylpropanoyl]amino]phenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 25118182 |
| Molecular Formula | C20H20FN3O5S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.11 |
| IUPAC Name | methyl N-[4-[[2-(4-fluoroindol-1-yl)-2-methylpropanoyl]amino]phenyl]sulfonylcarbamate |
| SMILES | COC(=O)NS(=O)(=O)c1ccc(NC(=O)C(C)(C)n2ccc3c(F)cccc32)cc1 |
| InChI | InChI=1S/C20H20FN3O5S/c1-20(2,24-12-11-15-16(21)5-4-6-17(15)24)18(25)22-13-7-9-14(10-8-13)30(27,28)23-19(26)29-3/h4-12H,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | WSLXXHRAAHSJRA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |