C13H15NO4 — CID 25118820
9-methoxy-4,4a,5,11-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazepin-2-one (PubChem CID 25118820) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 9-methoxy-4,4a,5,11-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazepin-2-one.
| Compound Name | 9-methoxy-4,4a,5,11-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazepin-2-one |
|---|---|
| PubChem CID | 25118820 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 9-methoxy-4,4a,5,11-tetrahydro-1H-[1,4]oxazino[3,4-c][1,4]benzoxazepin-2-one |
| SMILES | COc1ccc2c(c1)CN1CC(=O)OCC1CO2 |
| InChI | InChI=1S/C13H15NO4/c1-16-11-2-3-12-9(4-11)5-14-6-13(15)18-8-10(14)7-17-12/h2-4,10H,5-8H2,1H3 |
| InChIKey | KIJYXVMAWPJCSS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |