C19H27N3O4 — CID 25121958
8-[[4-methoxy-3-(2-methylpropoxy)phenyl]methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 25121958) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is 8-[[4-methoxy-3-(2-methylpropoxy)phenyl]methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-[[4-methoxy-3-(2-methylpropoxy)phenyl]methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 25121958 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 8-[[4-methoxy-3-(2-methylpropoxy)phenyl]methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | COc1ccc(CN2CCC3(CC2)NC(=O)NC3=O)cc1OCC(C)C |
| InChI | InChI=1S/C19H27N3O4/c1-13(2)12-26-16-10-14(4-5-15(16)25-3)11-22-8-6-19(7-9-22)17(23)20-18(24)21-19/h4-5,10,13H,6-9,11-12H2,1-3H3,(H2,20,21,23,24) |
| InChIKey | LIYFDLLHXPYLQC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|