C17H23N3O5S2 — CID 25126038
benzenesulfonic acid;[4-(pyrrolidin-1-ylsulfonylmethyl)phenyl]hydrazine (PubChem CID 25126038) has the molecular formula C17H23N3O5S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is benzenesulfonic acid;[4-(pyrrolidin-1-ylsulfonylmethyl)phenyl]hydrazine.
| Compound Name | benzenesulfonic acid;[4-(pyrrolidin-1-ylsulfonylmethyl)phenyl]hydrazine |
|---|---|
| PubChem CID | 25126038 |
| Molecular Formula | C17H23N3O5S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | benzenesulfonic acid;[4-(pyrrolidin-1-ylsulfonylmethyl)phenyl]hydrazine |
| SMILES | NNc1ccc(CS(=O)(=O)N2CCCC2)cc1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C11H17N3O2S.C6H6O3S/c12-13-11-5-3-10(4-6-11)9-17(15,16)14-7-1-2-8-14;7-10(8,9)6-4-2-1-3-5-6/h3-6,13H,1-2,7-9,12H2;1-5H,(H,7,8,9) |
| InChIKey | OUJWTJVVNXDLAB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|