C30H40F3N6O2+ — CID 25128986
bis(2-aminoethyl)-[(4S)-4-amino-5-[[(2S)-4-naphthalen-2-yl-1-oxo-1-(2,3,4-trifluoroanilino)butan-2-yl]amino]-5-oxopentyl]-methylazanium (PubChem CID 25128986) has the molecular formula C30H40F3N6O2+ and a molecular weight of 573.68 g/mol. Its IUPAC name is bis(2-aminoethyl)-[(4S)-4-amino-5-[[(2S)-4-naphthalen-2-yl-1-oxo-1-(2,3,4-trifluoroanilino)butan-2-yl]amino]-5-oxopentyl]-methylazanium.
| Compound Name | bis(2-aminoethyl)-[(4S)-4-amino-5-[[(2S)-4-naphthalen-2-yl-1-oxo-1-(2,3,4-trifluoroanilino)butan-2-yl]amino]-5-oxopentyl]-methylazanium |
|---|---|
| PubChem CID | 25128986 |
| Molecular Formula | C30H40F3N6O2+ |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.32 |
| IUPAC Name | bis(2-aminoethyl)-[(4S)-4-amino-5-[[(2S)-4-naphthalen-2-yl-1-oxo-1-(2,3,4-trifluoroanilino)butan-2-yl]amino]-5-oxopentyl]-methylazanium |
| SMILES | C[N+](CCN)(CCN)CCC[C@H](N)C(=O)N[C@@H](CCc1ccc2ccccc2c1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C30H39F3N6O2/c1-39(17-14-34,18-15-35)16-4-7-24(36)29(40)38-26(30(41)37-25-13-11-23(31)27(32)28(25)33)12-9-20-8-10-21-5-2-3-6-22(21)19-20/h2-3,5-6,8,10-11,13,19,24,26H,4,7,9,12,14-18,34-36H2,1H3,(H-,37,38,40,41)/p+1/t24-,26-/m0/s1 |
| InChIKey | CSKLVUVQALROKO-AHWVRZQESA-O |
| XLogP | 2.78 |
| TPSA | 136.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|