C22H32O5 — CID 25131128
methyl (1'S,3'S,3'aR,6'aS)-3'-but-3-enyl-5,5-dimethyl-2'-oxo-1'-prop-2-enylspiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate (PubChem CID 25131128) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is methyl (1'S,3'S,3'aR,6'aS)-3'-but-3-enyl-5,5-dimethyl-2'-oxo-1'-prop-2-enylspiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate.
| Compound Name | methyl (1'S,3'S,3'aR,6'aS)-3'-but-3-enyl-5,5-dimethyl-2'-oxo-1'-prop-2-enylspiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate |
|---|---|
| PubChem CID | 25131128 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | methyl (1'S,3'S,3'aR,6'aS)-3'-but-3-enyl-5,5-dimethyl-2'-oxo-1'-prop-2-enylspiro[1,3-dioxane-2,5'-3a,4,6,6a-tetrahydro-3H-pentalene]-1'-carboxylate |
| SMILES | C=CCC[C@@H]1C(=O)[C@@](CC=C)(C(=O)OC)[C@H]2CC3(C[C@@H]12)OCC(C)(C)CO3 |
| InChI | InChI=1S/C22H32O5/c1-6-8-9-15-16-11-21(26-13-20(3,4)14-27-21)12-17(16)22(10-7-2,18(15)23)19(24)25-5/h6-7,15-17H,1-2,8-14H2,3-5H3/t15-,16-,17-,22-/m0/s1 |
| InChIKey | DTBFUDKDIOOECC-DOWNOZBLSA-N |
| XLogP | 3.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|