C23H27NO3S — CID 25135336
(1E)-1-[(3R,4S)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-phenylazetidin-2-ylidene]pentan-2-one (PubChem CID 25135336) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is (1E)-1-[(3R,4S)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-phenylazetidin-2-ylidene]pentan-2-one.
| Compound Name | (1E)-1-[(3R,4S)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-phenylazetidin-2-ylidene]pentan-2-one |
|---|---|
| PubChem CID | 25135336 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (1E)-1-[(3R,4S)-3-ethyl-1-(4-methylphenyl)sulfonyl-4-phenylazetidin-2-ylidene]pentan-2-one |
| SMILES | CCCC(=O)/C=C1\[C@H](CC)[C@@H](c2ccccc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H27NO3S/c1-4-9-19(25)16-22-21(5-2)23(18-10-7-6-8-11-18)24(22)28(26,27)20-14-12-17(3)13-15-20/h6-8,10-16,21,23H,4-5,9H2,1-3H3/b22-16+/t21-,23+/m0/s1 |
| InChIKey | LHINUJBPRCGFGD-NETZJVHVSA-N |
| XLogP | 5.02 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|