C40H78O6Si3 — CID 25138567
methyl (2Z,4E,6S,7S,9S,10Z,12S,13R,14S,16R)-7,9,13-tris[[tert-butyl(dimethyl)silyl]oxy]-6,12,14,16-tetramethyl-17-oxoheptadeca-2,4,10-trienoate (PubChem CID 25138567) has the molecular formula C40H78O6Si3 and a molecular weight of 739.32 g/mol. Its IUPAC name is methyl (2Z,4E,6S,7S,9S,10Z,12S,13R,14S,16R)-7,9,13-tris[[tert-butyl(dimethyl)silyl]oxy]-6,12,14,16-tetramethyl-17-oxoheptadeca-2,4,10-trienoate.
| Compound Name | methyl (2Z,4E,6S,7S,9S,10Z,12S,13R,14S,16R)-7,9,13-tris[[tert-butyl(dimethyl)silyl]oxy]-6,12,14,16-tetramethyl-17-oxoheptadeca-2,4,10-trienoate |
|---|---|
| PubChem CID | 25138567 |
| Molecular Formula | C40H78O6Si3 |
| Molecular Weight | 739.32 g/mol |
| Exact Mass | 738.51 |
| IUPAC Name | methyl (2Z,4E,6S,7S,9S,10Z,12S,13R,14S,16R)-7,9,13-tris[[tert-butyl(dimethyl)silyl]oxy]-6,12,14,16-tetramethyl-17-oxoheptadeca-2,4,10-trienoate |
| SMILES | COC(=O)/C=C\C=C\[C@H](C)[C@H](C[C@@H](/C=C\[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@@H](C)C=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C40H78O6Si3/c1-30(29-41)27-33(4)37(46-49(19,20)40(11,12)13)32(3)25-26-34(44-47(15,16)38(5,6)7)28-35(45-48(17,18)39(8,9)10)31(2)23-21-22-24-36(42)43-14/h21-26,29-35,37H,27-28H2,1-20H3/b23-21+,24-22-,26-25-/t30-,31+,32+,33+,34-,35+,37+/m1/s1 |
| InChIKey | ARRBZXZKYIQSBG-QGBLFFLISA-N |
| XLogP | 11.52 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.32 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|