C15H12N2O2S — CID 25139169
3-[3-(4-methoxyphenyl)-1,2,4-thiadiazol-5-yl]phenol (PubChem CID 25139169) has the molecular formula C15H12N2O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-[3-(4-methoxyphenyl)-1,2,4-thiadiazol-5-yl]phenol.
| Compound Name | 3-[3-(4-methoxyphenyl)-1,2,4-thiadiazol-5-yl]phenol |
|---|---|
| PubChem CID | 25139169 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 3-[3-(4-methoxyphenyl)-1,2,4-thiadiazol-5-yl]phenol |
| SMILES | COc1ccc(-c2nsc(-c3cccc(O)c3)n2)cc1 |
| InChI | InChI=1S/C15H12N2O2S/c1-19-13-7-5-10(6-8-13)14-16-15(20-17-14)11-3-2-4-12(18)9-11/h2-9,18H,1H3 |
| InChIKey | PRVNAYNCRLKGGM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |