C26H30ClF2N3O2 — CID 25139916
3-[cyclopropylmethyl-[4-(5-fluoroindol-1-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide;hydrochloride (PubChem CID 25139916) has the molecular formula C26H30ClF2N3O2 and a molecular weight of 489.99 g/mol. Its IUPAC name is 3-[cyclopropylmethyl-[4-(5-fluoroindol-1-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide;hydrochloride.
| Compound Name | 3-[cyclopropylmethyl-[4-(5-fluoroindol-1-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 25139916 |
| Molecular Formula | C26H30ClF2N3O2 |
| Molecular Weight | 489.99 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 3-[cyclopropylmethyl-[4-(5-fluoroindol-1-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide;hydrochloride |
| SMILES | Cl.NC(=O)c1ccc(F)c2c1CC(N(CCCCn1ccc3cc(F)ccc31)CC1CC1)CO2 |
| InChI | InChI=1S/C26H29F2N3O2.ClH/c27-19-5-8-24-18(13-19)9-12-30(24)10-1-2-11-31(15-17-3-4-17)20-14-22-21(26(29)32)6-7-23(28)25(22)33-16-20;/h5-9,12-13,17,20H,1-4,10-11,14-16H2,(H2,29,32);1H |
| InChIKey | UDXVMIBCMJXQEC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.99 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|