C26H29F2N3O2 — CID 25139914
3-[cyclopropylmethyl-[4-(4-fluoroindol-1-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide (PubChem CID 25139914) has the molecular formula C26H29F2N3O2 and a molecular weight of 453.53 g/mol. Its IUPAC name is 3-[cyclopropylmethyl-[4-(4-fluoroindol-1-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide.
| Compound Name | 3-[cyclopropylmethyl-[4-(4-fluoroindol-1-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide |
|---|---|
| PubChem CID | 25139914 |
| Molecular Formula | C26H29F2N3O2 |
| Molecular Weight | 453.53 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | 3-[cyclopropylmethyl-[4-(4-fluoroindol-1-yl)butyl]amino]-8-fluoro-3,4-dihydro-2H-chromene-5-carboxamide |
| SMILES | NC(=O)c1ccc(F)c2c1CC(N(CCCCn1ccc3c(F)cccc31)CC1CC1)CO2 |
| InChI | InChI=1S/C26H29F2N3O2/c27-22-4-3-5-24-20(22)10-13-30(24)11-1-2-12-31(15-17-6-7-17)18-14-21-19(26(29)32)8-9-23(28)25(21)33-16-18/h3-5,8-10,13,17-18H,1-2,6-7,11-12,14-16H2,(H2,29,32) |
| InChIKey | RGWFYUYDDNFMLT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 60.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|