C22H24FN3O2 — CID 11326500
8-fluoro-3-(4-indol-1-ylbutylamino)-3,4-dihydro-2H-chromene-5-carboxamide (PubChem CID 11326500) has the molecular formula C22H24FN3O2 and a molecular weight of 381.45 g/mol. Its IUPAC name is 8-fluoro-3-(4-indol-1-ylbutylamino)-3,4-dihydro-2H-chromene-5-carboxamide.
| Compound Name | 8-fluoro-3-(4-indol-1-ylbutylamino)-3,4-dihydro-2H-chromene-5-carboxamide |
|---|---|
| PubChem CID | 11326500 |
| Molecular Formula | C22H24FN3O2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 8-fluoro-3-(4-indol-1-ylbutylamino)-3,4-dihydro-2H-chromene-5-carboxamide |
| SMILES | NC(=O)c1ccc(F)c2c1CC(NCCCCn1ccc3ccccc31)CO2 |
| InChI | InChI=1S/C22H24FN3O2/c23-19-8-7-17(22(24)27)18-13-16(14-28-21(18)19)25-10-3-4-11-26-12-9-15-5-1-2-6-20(15)26/h1-2,5-9,12,16,25H,3-4,10-11,13-14H2,(H2,24,27) |
| InChIKey | RYANQTMJLWBXDA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|