C8H5NO3 — CID 25142579
3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione (PubChem CID 25142579) has the molecular formula C8H5NO3 and a molecular weight of 163.13 g/mol. Its IUPAC name is 3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione.
| Compound Name | 3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 25142579 |
| Molecular Formula | C8H5NO3 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.03 |
| IUPAC Name | 3a,7a-dihydro-4,7-epoxyisoindole-1,3-dione |
| SMILES | O=C1NC(=O)C2c3ccc(o3)C12 |
| InChI | InChI=1S/C8H5NO3/c10-7-5-3-1-2-4(12-3)6(5)8(11)9-7/h1-2,5-6H,(H,9,10,11) |
| InChIKey | RZQSJDXAPAKEGK-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|