C19H22O7 — CID 25145887
methyl (3S,4S)-3,4-dihydroxy-6-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5-carboxylate (PubChem CID 25145887) has the molecular formula C19H22O7 and a molecular weight of 362.38 g/mol. Its IUPAC name is methyl (3S,4S)-3,4-dihydroxy-6-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5-carboxylate.
| Compound Name | methyl (3S,4S)-3,4-dihydroxy-6-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 25145887 |
| Molecular Formula | C19H22O7 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | methyl (3S,4S)-3,4-dihydroxy-6-(methoxymethoxy)-2,2-dimethyl-3,4-dihydrobenzo[h]chromene-5-carboxylate |
| SMILES | COCOc1c(C(=O)OC)c2c(c3ccccc13)OC(C)(C)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C19H22O7/c1-19(2)17(21)14(20)12-13(18(22)24-4)15(25-9-23-3)10-7-5-6-8-11(10)16(12)26-19/h5-8,14,17,20-21H,9H2,1-4H3/t14-,17-/m0/s1 |
| InChIKey | ALMNTOXARBXGHO-YOEHRIQHSA-N |
| XLogP | 2.17 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|