C23H16Cl2FNO4 — CID 25146009
[4-[3-(2,4-dichlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2-methoxyphenyl] 2-fluorobenzoate (PubChem CID 25146009) has the molecular formula C23H16Cl2FNO4 and a molecular weight of 460.29 g/mol. Its IUPAC name is [4-[3-(2,4-dichlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2-methoxyphenyl] 2-fluorobenzoate.
| Compound Name | [4-[3-(2,4-dichlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2-methoxyphenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 25146009 |
| Molecular Formula | C23H16Cl2FNO4 |
| Molecular Weight | 460.29 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | [4-[3-(2,4-dichlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2-methoxyphenyl] 2-fluorobenzoate |
| SMILES | COc1cc(C2CC(c3ccc(Cl)cc3Cl)=NO2)ccc1OC(=O)c1ccccc1F |
| InChI | InChI=1S/C23H16Cl2FNO4/c1-29-22-10-13(6-9-20(22)30-23(28)16-4-2-3-5-18(16)26)21-12-19(27-31-21)15-8-7-14(24)11-17(15)25/h2-11,21H,12H2,1H3 |
| InChIKey | QDTZMKQOPANOTP-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.29 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|