C21H22N2O6S — CID 25146089
dimethyl (E,4Z)-4-[[4-(benzylsulfamoyl)anilino]methylidene]pent-2-enedioate (PubChem CID 25146089) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is dimethyl (E,4Z)-4-[[4-(benzylsulfamoyl)anilino]methylidene]pent-2-enedioate.
| Compound Name | dimethyl (E,4Z)-4-[[4-(benzylsulfamoyl)anilino]methylidene]pent-2-enedioate |
|---|---|
| PubChem CID | 25146089 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | dimethyl (E,4Z)-4-[[4-(benzylsulfamoyl)anilino]methylidene]pent-2-enedioate |
| SMILES | COC(=O)/C=C/C(=C/Nc1ccc(S(=O)(=O)NCc2ccccc2)cc1)C(=O)OC |
| InChI | InChI=1S/C21H22N2O6S/c1-28-20(24)13-8-17(21(25)29-2)15-22-18-9-11-19(12-10-18)30(26,27)23-14-16-6-4-3-5-7-16/h3-13,15,22-23H,14H2,1-2H3/b13-8+,17-15- |
| InChIKey | JKDBCWOSMKECSC-AULHHWSNSA-N |
| XLogP | 2.36 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|