C17H22N2O6S — CID 25146285
dimethyl (E,4Z)-4-[[4-(propylsulfamoyl)anilino]methylidene]pent-2-enedioate (PubChem CID 25146285) has the molecular formula C17H22N2O6S and a molecular weight of 382.44 g/mol. Its IUPAC name is dimethyl (E,4Z)-4-[[4-(propylsulfamoyl)anilino]methylidene]pent-2-enedioate.
| Compound Name | dimethyl (E,4Z)-4-[[4-(propylsulfamoyl)anilino]methylidene]pent-2-enedioate |
|---|---|
| PubChem CID | 25146285 |
| Molecular Formula | C17H22N2O6S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | dimethyl (E,4Z)-4-[[4-(propylsulfamoyl)anilino]methylidene]pent-2-enedioate |
| SMILES | CCCNS(=O)(=O)c1ccc(N/C=C(/C=C/C(=O)OC)C(=O)OC)cc1 |
| InChI | InChI=1S/C17H22N2O6S/c1-4-11-19-26(22,23)15-8-6-14(7-9-15)18-12-13(17(21)25-3)5-10-16(20)24-2/h5-10,12,18-19H,4,11H2,1-3H3/b10-5+,13-12- |
| InChIKey | GGNCIGBXNLXGNX-QCTORNHGSA-N |
| XLogP | 1.57 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|