C14H18F3NO3 — CID 25146159
N-[2,2,2-trifluoro-1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-en-1-amine (PubChem CID 25146159) has the molecular formula C14H18F3NO3 and a molecular weight of 305.30 g/mol. Its IUPAC name is N-[2,2,2-trifluoro-1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-en-1-amine.
| Compound Name | N-[2,2,2-trifluoro-1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 25146159 |
| Molecular Formula | C14H18F3NO3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[2,2,2-trifluoro-1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-en-1-amine |
| SMILES | C=CCNC(c1cc(OC)c(OC)c(OC)c1)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO3/c1-5-6-18-13(14(15,16)17)9-7-10(19-2)12(21-4)11(8-9)20-3/h5,7-8,13,18H,1,6H2,2-4H3 |
| InChIKey | QYLMOPUFYALYKW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|