C30H28N2O6S2 — CID 25146296
methyl (6aR,9S)-4,7-bis-(4-methylphenyl)sulfonyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxylate (PubChem CID 25146296) has the molecular formula C30H28N2O6S2 and a molecular weight of 576.70 g/mol. Its IUPAC name is methyl (6aR,9S)-4,7-bis-(4-methylphenyl)sulfonyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxylate.
| Compound Name | methyl (6aR,9S)-4,7-bis-(4-methylphenyl)sulfonyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxylate |
|---|---|
| PubChem CID | 25146296 |
| Molecular Formula | C30H28N2O6S2 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | methyl (6aR,9S)-4,7-bis-(4-methylphenyl)sulfonyl-6,6a,8,9-tetrahydroindolo[4,3-fg]quinoline-9-carboxylate |
| SMILES | COC(=O)[C@H]1C=C2c3cccc4c3c(cn4S(=O)(=O)c3ccc(C)cc3)C[C@H]2N(S(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C30H28N2O6S2/c1-19-7-11-23(12-8-19)39(34,35)31-17-21-16-28-26(25-5-4-6-27(31)29(21)25)15-22(30(33)38-3)18-32(28)40(36,37)24-13-9-20(2)10-14-24/h4-15,17,22,28H,16,18H2,1-3H3/t22-,28+/m0/s1 |
| InChIKey | ICRSDZRCTVTNHO-RBISFHTESA-N |
| XLogP | 4.30 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |