C34H61NO5Si — CID 25146398
tert-butyl N-[(E,2S,3R,8R,10R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[4-(methoxymethoxy)phenyl]-8,10-dimethyldodec-6-en-2-yl]-N-methylcarbamate (PubChem CID 25146398) has the molecular formula C34H61NO5Si and a molecular weight of 591.95 g/mol. Its IUPAC name is tert-butyl N-[(E,2S,3R,8R,10R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[4-(methoxymethoxy)phenyl]-8,10-dimethyldodec-6-en-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(E,2S,3R,8R,10R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[4-(methoxymethoxy)phenyl]-8,10-dimethyldodec-6-en-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 25146398 |
| Molecular Formula | C34H61NO5Si |
| Molecular Weight | 591.95 g/mol |
| Exact Mass | 591.43 |
| IUPAC Name | tert-butyl N-[(E,2S,3R,8R,10R)-3-[tert-butyl(dimethyl)silyl]oxy-1-[4-(methoxymethoxy)phenyl]-8,10-dimethyldodec-6-en-2-yl]-N-methylcarbamate |
| SMILES | CC[C@@H](C)C[C@@H](C)/C=C/CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](Cc1ccc(OCOC)cc1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H61NO5Si/c1-14-26(2)23-27(3)17-15-16-18-31(40-41(12,13)34(7,8)9)30(35(10)32(36)39-33(4,5)6)24-28-19-21-29(22-20-28)38-25-37-11/h15,17,19-22,26-27,30-31H,14,16,18,23-25H2,1-13H3/b17-15+/t26-,27+,30+,31-/m1/s1 |
| InChIKey | PFSBQJIFNRQTQB-JJBYCRIRSA-N |
| XLogP | 9.25 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.95 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|