C8H12N2O3S — CID 25147405
1-(2,3-dihydroxypropyl)-4-methylsulfanylpyrimidin-2-one (PubChem CID 25147405) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 1-(2,3-dihydroxypropyl)-4-methylsulfanylpyrimidin-2-one.
| Compound Name | 1-(2,3-dihydroxypropyl)-4-methylsulfanylpyrimidin-2-one |
|---|---|
| PubChem CID | 25147405 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1-(2,3-dihydroxypropyl)-4-methylsulfanylpyrimidin-2-one |
| SMILES | CSc1ccn(CC(O)CO)c(=O)n1 |
| InChI | InChI=1S/C8H12N2O3S/c1-14-7-2-3-10(8(13)9-7)4-6(12)5-11/h2-3,6,11-12H,4-5H2,1H3 |
| InChIKey | ROPCLNBZIRPLGQ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |