C21H31F6N5O5 — CID 25149514
4-cyclohexyl-N-[N'-[3-(1H-imidazol-5-yl)propyl]carbamimidoyl]butanamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 25149514) has the molecular formula C21H31F6N5O5 and a molecular weight of 547.50 g/mol. Its IUPAC name is 4-cyclohexyl-N-[N'-[3-(1H-imidazol-5-yl)propyl]carbamimidoyl]butanamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-cyclohexyl-N-[N'-[3-(1H-imidazol-5-yl)propyl]carbamimidoyl]butanamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 25149514 |
| Molecular Formula | C21H31F6N5O5 |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 4-cyclohexyl-N-[N'-[3-(1H-imidazol-5-yl)propyl]carbamimidoyl]butanamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | N/C(=N\CCCc1cnc[nH]1)NC(=O)CCCC1CCCCC1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H29N5O.2C2HF3O2/c18-17(20-11-5-9-15-12-19-13-21-15)22-16(23)10-4-8-14-6-2-1-3-7-14;2*3-2(4,5)1(6)7/h12-14H,1-11H2,(H,19,21)(H3,18,20,22,23);2*(H,6,7) |
| InChIKey | AEWQFTIXRLFBOL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 170.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|